| Catalog |
ACM9000695-12 |
| CAS |
9000-69-5 |
| Description |
Pectin is a naturally occurring polysaccharide (complex carbohydrate) found in the cell walls of fruits and vegetables. |
| Synonyms |
Polyhalactyronic acid |
| IUPAC Name |
2,3,4,5-tetrahydroxypentanal |
| Molecular Formula |
C5H10O5 |
| Canonical SMILES |
C(C(C(C(C=O)O)O)O)O |
| InChI |
PYMYPHUHKUWMLA-UHFFFAOYSA-N |
| InChI Key |
InChI=1S/C5H10O5/c6-1-3(8)5(10)4(9)2-7/h1,3-5,7-10H,2H2 |
| Melting Point |
174-180 °C(dec.) |
| Flash Point |
219.2°C |
| Density |
1.508 g/cm³ |
| Appearance |
white to light yellow powder and it is odorless |
| Application |
1. Food thickener: Pectin is commonly used in food as a gelling agent and thickener. It is particularly useful in making jams, jellies, and fruit preserves.
2. Constipation relief: Pectin has a mild laxative effect and can help relieve symptoms of constipation.
3. Cholesterol reduction: Pectin can bind with cholesterol in the intestine, reducing its absorption and potentially lower blood cholesterol levels.
4. Blood sugar control: Pectin can slow down the absorption of carbohydrates, which can help regulate blood sugar levels in people with diabetes.
5. Wound healing: Pectin has been shown to accelerate the healing of certain types of wounds, possibly by promoting cell growth.
6. Industrial uses: Pectin is used in the industrial production of textiles, paper, and cosmetics. |
| Storage |
storage temp. 2-8°C |
| Assay |
0.99 |
| EC Number |
232-553-0 |
| Form |
lyophilized powder |
| MDL Number |
MFCD00081838 |
| Packaging |
1 g in poly bottle |
| Stability |
Stable under normal shipping and handling conditions. |
