| Catalog |
ACM16111072 |
| CAS |
16111-07-2 |
| Structure |  |
| Description |
Alfa Chemistry offers 1-(2-Hydroxyethyl)-3,3-dimethylindolino-6'-nitrobenzopyrylospiran products for various research purposes. Please contact us by email if you do not find the specification you are looking for on this page. |
| Synonyms |
1'-(2-Hydroxyethyl)-3',3'-dimethyl-6-nitrospiro[1(2H)-benzopyran-2,2'-indoline] |
| IUPAC Name |
2-(3',3'-dimethyl-6-nitrospiro[chromene-2,2'-indole]-1'-yl)ethanol |
| Molecular Weight |
352.39 |
| Molecular Formula |
C20H20N2O4 |
| Canonical SMILES |
CC1(C2=CC=CC=C2N(C13C=CC4=C(O3)C=CC(=C4)[N+](=O)[O-])CCO)C |
| InChI |
InChI=1S/C20H20N2O4/c1-19(2)16-5-3-4-6-17(16)21(11-12-23)20(19)10-9-14-13-15(22(24)25)7-8-18(14)26-20/h3-10,13,23H,11-12H2,1-2H3 |
| InChI Key |
FGJPKPQMQFZPJY-UHFFFAOYSA-N |
| Melting Point |
165 °C |
| Purity |
>93.0%(T)(HPLC) |
| Appearance |
Orange to Brown to Dark purple powder to crystal |
| Application |
Photochromic materials are further developed for a light-modulating materials, optical recording media, optical switches, and functional inks. |
| Form |
Solid |
| MDL Number |
MFCD00369031 |
| Packaging |
1g/5g |
| Type |
Spiropyrans [Photochromic Dyes] |
